C17H21N4O2P — CID 174445331
(8-methoxy-2-methyl-7H-purin-6-yl)-(2,4,6-trimethylphenyl)methanone;phosphane (PubChem CID 174445331) has the molecular formula C17H21N4O2P and a molecular weight of 344.36 g/mol. Its IUPAC name is (8-methoxy-2-methyl-7H-purin-6-yl)-(2,4,6-trimethylphenyl)methanone;phosphane.
| Compound Name | (8-methoxy-2-methyl-7H-purin-6-yl)-(2,4,6-trimethylphenyl)methanone;phosphane |
|---|---|
| PubChem CID | 174445331 |
| Molecular Formula | C17H21N4O2P |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (8-methoxy-2-methyl-7H-purin-6-yl)-(2,4,6-trimethylphenyl)methanone;phosphane |
| SMILES | COc1nc2nc(C)nc(C(=O)c3c(C)cc(C)cc3C)c2[nH]1.P |
| InChI | InChI=1S/C17H18N4O2.H3P/c1-8-6-9(2)12(10(3)7-8)15(22)13-14-16(19-11(4)18-13)21-17(20-14)23-5;/h6-7H,1-5H3,(H,18,19,20,21);1H3 |
| InChIKey | HQKIEYFSZCQLEV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|