C14H20F3N5O4 — CID 66727033
2-[(2S)-hexan-2-yl]oxy-8-methoxy-7H-purin-6-amine;2,2,2-trifluoroacetic acid (PubChem CID 66727033) has the molecular formula C14H20F3N5O4 and a molecular weight of 379.34 g/mol. Its IUPAC name is 2-[(2S)-hexan-2-yl]oxy-8-methoxy-7H-purin-6-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(2S)-hexan-2-yl]oxy-8-methoxy-7H-purin-6-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66727033 |
| Molecular Formula | C14H20F3N5O4 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-[(2S)-hexan-2-yl]oxy-8-methoxy-7H-purin-6-amine;2,2,2-trifluoroacetic acid |
| SMILES | CCCC[C@H](C)Oc1nc(N)c2[nH]c(OC)nc2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H19N5O2.C2HF3O2/c1-4-5-6-7(2)19-12-15-9(13)8-10(17-12)16-11(14-8)18-3;3-2(4,5)1(6)7/h7H,4-6H2,1-3H3,(H3,13,14,15,16,17);(H,6,7)/t7-;/m0./s1 |
| InChIKey | OAVLOPBSZFJABM-FJXQXJEOSA-N |
| XLogP | 2.53 |
| TPSA | 136.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |