C6H7N5O2 — CID 89175447
6-amino-8-methoxy-1,7-dihydropurin-2-one (PubChem CID 89175447) has the molecular formula C6H7N5O2 and a molecular weight of 181.16 g/mol. Its IUPAC name is 6-amino-8-methoxy-1,7-dihydropurin-2-one.
| Compound Name | 6-amino-8-methoxy-1,7-dihydropurin-2-one |
|---|---|
| PubChem CID | 89175447 |
| Molecular Formula | C6H7N5O2 |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 6-amino-8-methoxy-1,7-dihydropurin-2-one |
| SMILES | COc1nc2nc(=O)[nH]c(N)c2[nH]1 |
| InChI | InChI=1S/C6H7N5O2/c1-13-6-8-2-3(7)9-5(12)10-4(2)11-6/h1H3,(H4,7,8,9,10,11,12) |
| InChIKey | WKNYMJXXJFBCKL-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |