C7H8ClN3O3 — CID 135678313
4-amino-5-(2-chloroacetyl)-2-methoxy-1H-pyrimidin-6-one (PubChem CID 135678313) has the molecular formula C7H8ClN3O3 and a molecular weight of 217.61 g/mol. Its IUPAC name is 4-amino-5-(2-chloroacetyl)-2-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-amino-5-(2-chloroacetyl)-2-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135678313 |
| Molecular Formula | C7H8ClN3O3 |
| Molecular Weight | 217.61 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 4-amino-5-(2-chloroacetyl)-2-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1nc(N)c(C(=O)CCl)c(=O)[nH]1 |
| InChI | InChI=1S/C7H8ClN3O3/c1-14-7-10-5(9)4(3(12)2-8)6(13)11-7/h2H2,1H3,(H3,9,10,11,13) |
| InChIKey | HBPRWIGLMWYCMP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.61 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|