C8H9N5O — CID 24810988
4-amino-6-ethyl-3H-pteridin-2-one (PubChem CID 24810988) has the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. Its IUPAC name is 4-amino-6-ethyl-3H-pteridin-2-one.
| Compound Name | 4-amino-6-ethyl-3H-pteridin-2-one |
|---|---|
| PubChem CID | 24810988 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 4-amino-6-ethyl-3H-pteridin-2-one |
| SMILES | CCc1cnc2nc(=O)[nH]c(N)c2n1 |
| InChI | InChI=1S/C8H9N5O/c1-2-4-3-10-7-5(11-4)6(9)12-8(14)13-7/h3H,2H2,1H3,(H3,9,10,12,13,14) |
| InChIKey | WEAZVASKQKQFML-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |