C17H18N4O2 — CID 174445332
(8-methoxy-2-methyl-7H-purin-6-yl)-(2,4,6-trimethylphenyl)methanone (PubChem CID 174445332) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is (8-methoxy-2-methyl-7H-purin-6-yl)-(2,4,6-trimethylphenyl)methanone.
| Compound Name | (8-methoxy-2-methyl-7H-purin-6-yl)-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 174445332 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (8-methoxy-2-methyl-7H-purin-6-yl)-(2,4,6-trimethylphenyl)methanone |
| SMILES | COc1nc2nc(C)nc(C(=O)c3c(C)cc(C)cc3C)c2[nH]1 |
| InChI | InChI=1S/C17H18N4O2/c1-8-6-9(2)12(10(3)7-8)15(22)13-14-16(19-11(4)18-13)21-17(20-14)23-5/h6-7H,1-5H3,(H,18,19,20,21) |
| InChIKey | SLAKVOZWADLKFQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |