About magnesium;benzhydrylsilane;hydride
magnesium;benzhydrylsilane;hydride (PubChem CID 174447165) has the molecular formula C13H16MgSi
and a molecular weight of 224.66 g/mol. Its IUPAC name is magnesium;benzhydrylsilane;hydride.
Molecular Properties
| Compound Name | magnesium;benzhydrylsilane;hydride |
| PubChem CID | 174447165 |
| Molecular Formula | C13H16MgSi |
| Molecular Weight | 224.66 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | magnesium;benzhydrylsilane;hydride |
| SMILES | [H-].[H-].[Mg+2].[SiH3]C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H14Si.Mg.2H/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;;;/h1-10,13H,14H3;;;/q;+2;2*-1 |
| InChIKey | FRGTXFZKWTYATA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.66 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze magnesium;benzhydrylsilane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;benzhydrylsilane;hydride?
The IUPAC name of magnesium;benzhydrylsilane;hydride (CID 174447165) is magnesium;benzhydrylsilane;hydride.
What is the SMILES notation for magnesium;benzhydrylsilane;hydride?
The canonical SMILES for magnesium;benzhydrylsilane;hydride is [H-].[H-].[Mg+2].[SiH3]C(c1ccccc1)c1ccccc1.
What is the InChIKey of magnesium;benzhydrylsilane;hydride?
The InChIKey is FRGTXFZKWTYATA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Si.Mg.2H/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;;;/h1-10,13H,14H3;;;/q;+2;2*-1.
What are the key properties of magnesium;benzhydrylsilane;hydride?
magnesium;benzhydrylsilane;hydride has a molecular weight of 224.66 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;benzhydrylsilane;hydride is sourced from PubChem (CID 174447165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).