C16H12F2N4 — CID 169224852
3,6-bis[fluoro(phenyl)methyl]-1,2,4,5-tetrazine (PubChem CID 169224852) has the molecular formula C16H12F2N4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 3,6-bis[fluoro(phenyl)methyl]-1,2,4,5-tetrazine.
| Compound Name | 3,6-bis[fluoro(phenyl)methyl]-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 169224852 |
| Molecular Formula | C16H12F2N4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3,6-bis[fluoro(phenyl)methyl]-1,2,4,5-tetrazine |
| SMILES | FC(c1ccccc1)c1nnc(C(F)c2ccccc2)nn1 |
| InChI | InChI=1S/C16H12F2N4/c17-13(11-7-3-1-4-8-11)15-19-21-16(22-20-15)14(18)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | GPZUYDWZSMYKTE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |