C37H31FO2S — CID 174451351
2-[4-(4-fluorophenyl)phenyl]-3,4,5,6-tetrahydrochrysene;2-(2H-thiopyran-2-yl)acetic acid (PubChem CID 174451351) has the molecular formula C37H31FO2S and a molecular weight of 558.72 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)phenyl]-3,4,5,6-tetrahydrochrysene;2-(2H-thiopyran-2-yl)acetic acid.
| Compound Name | 2-[4-(4-fluorophenyl)phenyl]-3,4,5,6-tetrahydrochrysene;2-(2H-thiopyran-2-yl)acetic acid |
|---|---|
| PubChem CID | 174451351 |
| Molecular Formula | C37H31FO2S |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 2-[4-(4-fluorophenyl)phenyl]-3,4,5,6-tetrahydrochrysene;2-(2H-thiopyran-2-yl)acetic acid |
| SMILES | Fc1ccc(-c2ccc(C3=Cc4ccc5c(c4CC3)CCc3ccccc3-5)cc2)cc1.O=C(O)CC1C=CC=CS1 |
| InChI | InChI=1S/C30H23F.C7H8O2S/c31-26-14-9-21(10-15-26)20-5-7-22(8-6-20)24-12-16-28-25(19-24)13-18-29-27-4-2-1-3-23(27)11-17-30(28)29;8-7(9)5-6-3-1-2-4-10-6/h1-10,13-15,18-19H,11-12,16-17H2;1-4,6H,5H2,(H,8,9) |
| InChIKey | JXOOGCJVKLODGC-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|