C31H28N2O4S2 — CID 174431557
N-hydroxy-2-(methanesulfonamido)-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]acetamide (PubChem CID 174431557) has the molecular formula C31H28N2O4S2 and a molecular weight of 556.71 g/mol. Its IUPAC name is N-hydroxy-2-(methanesulfonamido)-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]acetamide.
| Compound Name | N-hydroxy-2-(methanesulfonamido)-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 174431557 |
| Molecular Formula | C31H28N2O4S2 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | N-hydroxy-2-(methanesulfonamido)-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]acetamide |
| SMILES | CS(=O)(=O)NCC(=O)N(O)c1cccc(-c2ccc(C3=Cc4ccc5c(c4CC3)CCc3ccccc3-5)s2)c1 |
| InChI | InChI=1S/C31H28N2O4S2/c1-39(36,37)32-19-31(34)33(35)24-7-4-6-22(18-24)29-15-16-30(38-29)23-11-12-26-21(17-23)10-14-27-25-8-3-2-5-20(25)9-13-28(26)27/h2-8,10,14-18,32,35H,9,11-13,19H2,1H3 |
| InChIKey | QWFOKEZTNVKTLS-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|