C48H53N3O6S2 — CID 174445276
3-(cyclohexylmethyl)-1-(oxan-2-yloxy)-1-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]urea;2-(1,1-dioxo-2H-thiopyran-2-yl)acetamide (PubChem CID 174445276) has the molecular formula C48H53N3O6S2 and a molecular weight of 832.10 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-1-(oxan-2-yloxy)-1-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]urea;2-(1,1-dioxo-2H-thiopyran-2-yl)acetamide.
| Compound Name | 3-(cyclohexylmethyl)-1-(oxan-2-yloxy)-1-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]urea;2-(1,1-dioxo-2H-thiopyran-2-yl)acetamide |
|---|---|
| PubChem CID | 174445276 |
| Molecular Formula | C48H53N3O6S2 |
| Molecular Weight | 832.10 g/mol |
| Exact Mass | 831.34 |
| IUPAC Name | 3-(cyclohexylmethyl)-1-(oxan-2-yloxy)-1-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]urea;2-(1,1-dioxo-2H-thiopyran-2-yl)acetamide |
| SMILES | NC(=O)CC1C=CC=CS1(=O)=O.O=C(NCC1CCCCC1)N(OC1CCCCO1)c1cccc(-c2ccc(C3=Cc4ccc5c(c4CC3)CCc3ccccc3-5)s2)c1 |
| InChI | InChI=1S/C41H44N2O3S.C7H9NO3S/c44-41(42-27-28-9-2-1-3-10-28)43(46-40-15-6-7-24-45-40)33-13-8-12-31(26-33)38-22-23-39(47-38)32-18-19-35-30(25-32)17-21-36-34-14-5-4-11-29(34)16-20-37(35)36;8-7(9)5-6-3-1-2-4-12(6,10)11/h4-5,8,11-14,17,21-23,25-26,28,40H,1-3,6-7,9-10,15-16,18-20,24,27H2,(H,42,44);1-4,6H,5H2,(H2,8,9) |
| InChIKey | NAHFQGSWIFVKDA-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.10 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|