C38H39NO4S — CID 174431423
N-(oxan-2-yloxy)-2-propan-2-yloxy-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]acetamide (PubChem CID 174431423) has the molecular formula C38H39NO4S and a molecular weight of 605.80 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-2-propan-2-yloxy-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]acetamide.
| Compound Name | N-(oxan-2-yloxy)-2-propan-2-yloxy-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 174431423 |
| Molecular Formula | C38H39NO4S |
| Molecular Weight | 605.80 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | N-(oxan-2-yloxy)-2-propan-2-yloxy-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]acetamide |
| SMILES | CC(C)OCC(=O)N(OC1CCCCO1)c1cccc(-c2ccc(C3=Cc4ccc5c(c4CC3)CCc3ccccc3-5)s2)c1 |
| InChI | InChI=1S/C38H39NO4S/c1-25(2)42-24-37(40)39(43-38-12-5-6-21-41-38)30-10-7-9-28(23-30)35-19-20-36(44-35)29-15-16-32-27(22-29)14-18-33-31-11-4-3-8-26(31)13-17-34(32)33/h3-4,7-11,14,18-20,22-23,25,38H,5-6,12-13,15-17,21,24H2,1-2H3 |
| InChIKey | KLTMUCNEMYLYEQ-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.80 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|