C43H44N2O7S2 — CID 174431369
2-(1,1-dioxo-2H-thiopyran-2-yl)acetamide;methyl N-(oxan-2-yloxy)-N-[[4-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]methyl]carbamate (PubChem CID 174431369) has the molecular formula C43H44N2O7S2 and a molecular weight of 764.97 g/mol. Its IUPAC name is 2-(1,1-dioxo-2H-thiopyran-2-yl)acetamide;methyl N-(oxan-2-yloxy)-N-[[4-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]methyl]carbamate.
| Compound Name | 2-(1,1-dioxo-2H-thiopyran-2-yl)acetamide;methyl N-(oxan-2-yloxy)-N-[[4-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 174431369 |
| Molecular Formula | C43H44N2O7S2 |
| Molecular Weight | 764.97 g/mol |
| Exact Mass | 764.26 |
| IUPAC Name | 2-(1,1-dioxo-2H-thiopyran-2-yl)acetamide;methyl N-(oxan-2-yloxy)-N-[[4-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]methyl]carbamate |
| SMILES | COC(=O)N(Cc1ccc(-c2ccc(C3=Cc4ccc5c(c4CC3)CCc3ccccc3-5)s2)cc1)OC1CCCCO1.NC(=O)CC1C=CC=CS1(=O)=O |
| InChI | InChI=1S/C36H35NO4S.C7H9NO3S/c1-39-36(38)37(41-35-8-4-5-21-40-35)23-24-9-11-26(12-10-24)33-19-20-34(42-33)28-15-16-30-27(22-28)14-18-31-29-7-3-2-6-25(29)13-17-32(30)31;8-7(9)5-6-3-1-2-4-12(6,10)11/h2-3,6-7,9-12,14,18-20,22,35H,4-5,8,13,15-17,21,23H2,1H3;1-4,6H,5H2,(H2,8,9) |
| InChIKey | DBTJFHRONVKFRJ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.97 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|