C31H27NO2S — CID 174431463
N-hydroxy-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]propanamide (PubChem CID 174431463) has the molecular formula C31H27NO2S and a molecular weight of 477.63 g/mol. Its IUPAC name is N-hydroxy-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]propanamide.
| Compound Name | N-hydroxy-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 174431463 |
| Molecular Formula | C31H27NO2S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-hydroxy-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]propanamide |
| SMILES | CCC(=O)N(O)c1cccc(-c2ccc(C3=Cc4ccc5c(c4CC3)CCc3ccccc3-5)s2)c1 |
| InChI | InChI=1S/C31H27NO2S/c1-2-31(33)32(34)24-8-5-7-22(19-24)29-16-17-30(35-29)23-12-13-26-21(18-23)11-15-27-25-9-4-3-6-20(25)10-14-28(26)27/h3-9,11,15-19,34H,2,10,12-14H2,1H3 |
| InChIKey | HBOPOIPPQFWCOE-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|