C39H41NO4S — CID 175237255
tert-butyl N-(oxan-2-yloxy)-N-[[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]methyl]carbamate (PubChem CID 175237255) has the molecular formula C39H41NO4S and a molecular weight of 619.83 g/mol. Its IUPAC name is tert-butyl N-(oxan-2-yloxy)-N-[[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-(oxan-2-yloxy)-N-[[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 175237255 |
| Molecular Formula | C39H41NO4S |
| Molecular Weight | 619.83 g/mol |
| Exact Mass | 619.28 |
| IUPAC Name | tert-butyl N-(oxan-2-yloxy)-N-[[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1cccc(-c2ccc(C3=Cc4ccc5c(c4CC3)CCc3ccccc3-5)s2)c1)OC1CCCCO1 |
| InChI | InChI=1S/C39H41NO4S/c1-39(2,3)43-38(41)40(44-37-13-6-7-22-42-37)25-26-9-8-11-29(23-26)35-20-21-36(45-35)30-16-17-32-28(24-30)15-19-33-31-12-5-4-10-27(31)14-18-34(32)33/h4-5,8-12,15,19-21,23-24,37H,6-7,13-14,16-18,22,25H2,1-3H3 |
| InChIKey | IPUJHBMHZBTMDR-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.83 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|