C37H35NO3S — CID 175238482
N-methyl-N-(oxan-2-yloxy)-3-[4-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]prop-2-enamide (PubChem CID 175238482) has the molecular formula C37H35NO3S and a molecular weight of 573.76 g/mol. Its IUPAC name is N-methyl-N-(oxan-2-yloxy)-3-[4-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]prop-2-enamide.
| Compound Name | N-methyl-N-(oxan-2-yloxy)-3-[4-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175238482 |
| Molecular Formula | C37H35NO3S |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | N-methyl-N-(oxan-2-yloxy)-3-[4-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]prop-2-enamide |
| SMILES | CN(OC1CCCCO1)C(=O)C=Cc1ccc(-c2ccc(C3=Cc4ccc5c(c4CC3)CCc3ccccc3-5)s2)cc1 |
| InChI | InChI=1S/C37H35NO3S/c1-38(41-37-8-4-5-23-40-37)36(39)22-11-25-9-12-27(13-10-25)34-20-21-35(42-34)29-16-17-31-28(24-29)15-19-32-30-7-3-2-6-26(30)14-18-33(31)32/h2-3,6-7,9-13,15,19-22,24,37H,4-5,8,14,16-18,23H2,1H3 |
| InChIKey | QEHCOJDOXROJBS-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|