C36H35NO4S — CID 175238494
ethyl N-(oxan-2-yloxy)-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]carbamate (PubChem CID 175238494) has the molecular formula C36H35NO4S and a molecular weight of 577.75 g/mol. Its IUPAC name is ethyl N-(oxan-2-yloxy)-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]carbamate.
| Compound Name | ethyl N-(oxan-2-yloxy)-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 175238494 |
| Molecular Formula | C36H35NO4S |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | ethyl N-(oxan-2-yloxy)-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]carbamate |
| SMILES | CCOC(=O)N(OC1CCCCO1)c1cccc(-c2ccc(C3=Cc4ccc5c(c4CC3)CCc3ccccc3-5)s2)c1 |
| InChI | InChI=1S/C36H35NO4S/c1-2-39-36(38)37(41-35-12-5-6-21-40-35)28-10-7-9-26(23-28)33-19-20-34(42-33)27-15-16-30-25(22-27)14-18-31-29-11-4-3-8-24(29)13-17-32(30)31/h3-4,7-11,14,18-20,22-23,35H,2,5-6,12-13,15-17,21H2,1H3 |
| InChIKey | GFQNUVHFEYKGON-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|