C42H39NO4S — CID 174445307
N-(oxan-2-yloxy)-2-phenylmethoxy-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]acetamide (PubChem CID 174445307) has the molecular formula C42H39NO4S and a molecular weight of 653.84 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-2-phenylmethoxy-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]acetamide.
| Compound Name | N-(oxan-2-yloxy)-2-phenylmethoxy-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 174445307 |
| Molecular Formula | C42H39NO4S |
| Molecular Weight | 653.84 g/mol |
| Exact Mass | 653.26 |
| IUPAC Name | N-(oxan-2-yloxy)-2-phenylmethoxy-N-[3-[5-(3,4,5,6-tetrahydrochrysen-2-yl)thiophen-2-yl]phenyl]acetamide |
| SMILES | O=C(COCc1ccccc1)N(OC1CCCCO1)c1cccc(-c2ccc(C3=Cc4ccc5c(c4CC3)CCc3ccccc3-5)s2)c1 |
| InChI | InChI=1S/C42H39NO4S/c44-41(28-45-27-29-9-2-1-3-10-29)43(47-42-15-6-7-24-46-42)34-13-8-12-32(26-34)39-22-23-40(48-39)33-18-19-36-31(25-33)17-21-37-35-14-5-4-11-30(35)16-20-38(36)37/h1-5,8-14,17,21-23,25-26,42H,6-7,15-16,18-20,24,27-28H2 |
| InChIKey | SYNMETFALXFWDU-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.84 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|