C37H32ClNO5S — CID 174431383
2-[4-(4-chlorophenoxy)phenyl]-3,4,5,6-tetrahydrochrysene;2-(1,1-dioxo-2H-thiopyran-2-yl)-N-hydroxyacetamide (PubChem CID 174431383) has the molecular formula C37H32ClNO5S and a molecular weight of 638.19 g/mol. Its IUPAC name is 2-[4-(4-chlorophenoxy)phenyl]-3,4,5,6-tetrahydrochrysene;2-(1,1-dioxo-2H-thiopyran-2-yl)-N-hydroxyacetamide.
| Compound Name | 2-[4-(4-chlorophenoxy)phenyl]-3,4,5,6-tetrahydrochrysene;2-(1,1-dioxo-2H-thiopyran-2-yl)-N-hydroxyacetamide |
|---|---|
| PubChem CID | 174431383 |
| Molecular Formula | C37H32ClNO5S |
| Molecular Weight | 638.19 g/mol |
| Exact Mass | 637.17 |
| IUPAC Name | 2-[4-(4-chlorophenoxy)phenyl]-3,4,5,6-tetrahydrochrysene;2-(1,1-dioxo-2H-thiopyran-2-yl)-N-hydroxyacetamide |
| SMILES | Clc1ccc(Oc2ccc(C3=Cc4ccc5c(c4CC3)CCc3ccccc3-5)cc2)cc1.O=C(CC1C=CC=CS1(=O)=O)NO |
| InChI | InChI=1S/C30H23ClO.C7H9NO4S/c31-24-10-14-26(15-11-24)32-25-12-5-20(6-13-25)22-8-16-28-23(19-22)9-18-29-27-4-2-1-3-21(27)7-17-30(28)29;9-7(8-10)5-6-3-1-2-4-13(6,11)12/h1-6,9-15,18-19H,7-8,16-17H2;1-4,6,10H,5H2,(H,8,9) |
| InChIKey | SHULKAJWQCYQHO-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.19 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|