C18H16O — CID 174835162
1,4,5,6-tetrahydrochrysen-1-ol (PubChem CID 174835162) has the molecular formula C18H16O and a molecular weight of 248.33 g/mol. Its IUPAC name is 1,4,5,6-tetrahydrochrysen-1-ol.
| Compound Name | 1,4,5,6-tetrahydrochrysen-1-ol |
|---|---|
| PubChem CID | 174835162 |
| Molecular Formula | C18H16O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1,4,5,6-tetrahydrochrysen-1-ol |
| SMILES | OC1C=CCc2c1ccc1c2CCc2ccccc2-1 |
| InChI | InChI=1S/C18H16O/c19-18-7-3-6-14-16-9-8-12-4-1-2-5-13(12)15(16)10-11-17(14)18/h1-5,7,10-11,18-19H,6,8-9H2 |
| InChIKey | GZTYGNMPMKFBOR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|