C19H18O3S — CID 174449893
1-methylsulfonyl-1,2,5,6-tetrahydrochrysen-4-ol (PubChem CID 174449893) has the molecular formula C19H18O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is 1-methylsulfonyl-1,2,5,6-tetrahydrochrysen-4-ol.
| Compound Name | 1-methylsulfonyl-1,2,5,6-tetrahydrochrysen-4-ol |
|---|---|
| PubChem CID | 174449893 |
| Molecular Formula | C19H18O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 1-methylsulfonyl-1,2,5,6-tetrahydrochrysen-4-ol |
| SMILES | CS(=O)(=O)C1CC=C(O)c2c1ccc1c2CCc2ccccc2-1 |
| InChI | InChI=1S/C19H18O3S/c1-23(21,22)18-11-10-17(20)19-15-7-6-12-4-2-3-5-13(12)14(15)8-9-16(18)19/h2-5,8-10,18,20H,6-7,11H2,1H3 |
| InChIKey | HCLIBTMBTIXSSP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |