About 2-aminoguanidine;4-oxopentanoic acid;hydrochloride
2-aminoguanidine;4-oxopentanoic acid;hydrochloride (PubChem CID 174454338) has the molecular formula C6H15ClN4O3
and a molecular weight of 226.66 g/mol. Its IUPAC name is 2-aminoguanidine;4-oxopentanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-aminoguanidine;4-oxopentanoic acid;hydrochloride |
| PubChem CID | 174454338 |
| Molecular Formula | C6H15ClN4O3 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-aminoguanidine;4-oxopentanoic acid;hydrochloride |
| SMILES | CC(=O)CCC(=O)O.Cl.NN=C(N)N |
| InChI | InChI=1S/C5H8O3.CH6N4.ClH/c1-4(6)2-3-5(7)8;2-1(3)5-4;/h2-3H2,1H3,(H,7,8);4H2,(H4,2,3,5);1H |
| InChIKey | JYOWHVCXEKXDRA-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoguanidine;4-oxopentanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoguanidine;4-oxopentanoic acid;hydrochloride?
The IUPAC name of 2-aminoguanidine;4-oxopentanoic acid;hydrochloride (CID 174454338) is 2-aminoguanidine;4-oxopentanoic acid;hydrochloride.
What is the SMILES notation for 2-aminoguanidine;4-oxopentanoic acid;hydrochloride?
The canonical SMILES for 2-aminoguanidine;4-oxopentanoic acid;hydrochloride is CC(=O)CCC(=O)O.Cl.NN=C(N)N.
What is the InChIKey of 2-aminoguanidine;4-oxopentanoic acid;hydrochloride?
The InChIKey is JYOWHVCXEKXDRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.CH6N4.ClH/c1-4(6)2-3-5(7)8;2-1(3)5-4;/h2-3H2,1H3,(H,7,8);4H2,(H4,2,3,5);1H.
What are the key properties of 2-aminoguanidine;4-oxopentanoic acid;hydrochloride?
2-aminoguanidine;4-oxopentanoic acid;hydrochloride has a molecular weight of 226.66 g/mol, XLogP of -1.00, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoguanidine;4-oxopentanoic acid;hydrochloride is sourced from PubChem (CID 174454338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).