About 2-aminoguanidine;urea
2-aminoguanidine;urea (PubChem CID 87270498) has the molecular formula C2H10N6O
and a molecular weight of 134.14 g/mol. Its IUPAC name is 2-aminoguanidine;urea.
Molecular Properties
| Compound Name | 2-aminoguanidine;urea |
| PubChem CID | 87270498 |
| Molecular Formula | C2H10N6O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | 2-aminoguanidine;urea |
| SMILES | NC(N)=O.NN=C(N)N |
| InChI | InChI=1S/CH6N4.CH4N2O/c2-1(3)5-4;2-1(3)4/h4H2,(H4,2,3,5);(H4,2,3,4) |
| InChIKey | HEWVGTJATYJWIE-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 159.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoguanidine;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoguanidine;urea?
The IUPAC name of 2-aminoguanidine;urea (CID 87270498) is 2-aminoguanidine;urea.
What is the SMILES notation for 2-aminoguanidine;urea?
The canonical SMILES for 2-aminoguanidine;urea is NC(N)=O.NN=C(N)N.
What is the InChIKey of 2-aminoguanidine;urea?
The InChIKey is HEWVGTJATYJWIE-UHFFFAOYSA-N. The full InChI is InChI=1S/CH6N4.CH4N2O/c2-1(3)5-4;2-1(3)4/h4H2,(H4,2,3,5);(H4,2,3,4).
What are the key properties of 2-aminoguanidine;urea?
2-aminoguanidine;urea has a molecular weight of 134.14 g/mol, XLogP of -2.84, 0 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoguanidine;urea is sourced from PubChem (CID 87270498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).