About 2-aminoguanidine;hydrazine
2-aminoguanidine;hydrazine (PubChem CID 158910954) has the molecular formula CH10N6
and a molecular weight of 106.13 g/mol. Its IUPAC name is 2-aminoguanidine;hydrazine.
Molecular Properties
| Compound Name | 2-aminoguanidine;hydrazine |
| PubChem CID | 158910954 |
| Molecular Formula | CH10N6 |
| Molecular Weight | 106.13 g/mol |
| Exact Mass | 106.10 |
| IUPAC Name | 2-aminoguanidine;hydrazine |
| SMILES | NN.NN=C(N)N |
| InChI | InChI=1S/CH6N4.H4N2/c2-1(3)5-4;1-2/h4H2,(H4,2,3,5);1-2H2 |
| InChIKey | JGQGTUOVIVSFSM-UHFFFAOYSA-N |
| XLogP | -3.05 |
| TPSA | 142.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.13 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoguanidine;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoguanidine;hydrazine?
The IUPAC name of 2-aminoguanidine;hydrazine (CID 158910954) is 2-aminoguanidine;hydrazine.
What is the SMILES notation for 2-aminoguanidine;hydrazine?
The canonical SMILES for 2-aminoguanidine;hydrazine is NN.NN=C(N)N.
What is the InChIKey of 2-aminoguanidine;hydrazine?
The InChIKey is JGQGTUOVIVSFSM-UHFFFAOYSA-N. The full InChI is InChI=1S/CH6N4.H4N2/c2-1(3)5-4;1-2/h4H2,(H4,2,3,5);1-2H2.
What are the key properties of 2-aminoguanidine;hydrazine?
2-aminoguanidine;hydrazine has a molecular weight of 106.13 g/mol, XLogP of -3.05, 0 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoguanidine;hydrazine is sourced from PubChem (CID 158910954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).