CH11N7 — CID 175854701
azane;1,1,2-triaminoguanidine (PubChem CID 175854701) has the molecular formula CH11N7 and a molecular weight of 121.15 g/mol. Its IUPAC name is azane;1,1,2-triaminoguanidine.
| Compound Name | azane;1,1,2-triaminoguanidine |
|---|---|
| PubChem CID | 175854701 |
| Molecular Formula | CH11N7 |
| Molecular Weight | 121.15 g/mol |
| Exact Mass | 121.11 |
| IUPAC Name | azane;1,1,2-triaminoguanidine |
| SMILES | N.NN=C(N)N(N)N |
| InChI | InChI=1S/CH8N6.H3N/c2-1(6-3)7(4)5;/h3-5H2,(H2,2,6);1H3 |
| InChIKey | VQFBAMPOTGTHEF-UHFFFAOYSA-N |
| XLogP | -2.61 |
| TPSA | 154.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.15 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|