About disodium;2-aminoguanidine;sulfate
disodium;2-aminoguanidine;sulfate (PubChem CID 172846071) has the molecular formula CH6N4Na2O4S
and a molecular weight of 216.13 g/mol. Its IUPAC name is disodium;2-aminoguanidine;sulfate.
Molecular Properties
| Compound Name | disodium;2-aminoguanidine;sulfate |
| PubChem CID | 172846071 |
| Molecular Formula | CH6N4Na2O4S |
| Molecular Weight | 216.13 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | disodium;2-aminoguanidine;sulfate |
| SMILES | NN=C(N)N.O=S(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/CH6N4.2Na.H2O4S/c2-1(3)5-4;;;1-5(2,3)4/h4H2,(H4,2,3,5);;;(H2,1,2,3,4)/q;2*+1;/p-2 |
| InChIKey | XLCOYLKSSYXQBC-UHFFFAOYSA-L |
| XLogP | -9.20 |
| TPSA | 170.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.13 |
| LogP ≤ 5 | -9.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-aminoguanidine;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-aminoguanidine;sulfate?
The IUPAC name of disodium;2-aminoguanidine;sulfate (CID 172846071) is disodium;2-aminoguanidine;sulfate.
What is the SMILES notation for disodium;2-aminoguanidine;sulfate?
The canonical SMILES for disodium;2-aminoguanidine;sulfate is NN=C(N)N.O=S(=O)([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;2-aminoguanidine;sulfate?
The InChIKey is XLCOYLKSSYXQBC-UHFFFAOYSA-L. The full InChI is InChI=1S/CH6N4.2Na.H2O4S/c2-1(3)5-4;;;1-5(2,3)4/h4H2,(H4,2,3,5);;;(H2,1,2,3,4)/q;2*+1;/p-2.
What are the key properties of disodium;2-aminoguanidine;sulfate?
disodium;2-aminoguanidine;sulfate has a molecular weight of 216.13 g/mol, XLogP of -9.20, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-aminoguanidine;sulfate is sourced from PubChem (CID 172846071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).