C17H28N4O5S — CID 174454412
[4-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate (PubChem CID 174454412) has the molecular formula C17H28N4O5S and a molecular weight of 400.50 g/mol. Its IUPAC name is [4-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate.
| Compound Name | [4-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate |
|---|---|
| PubChem CID | 174454412 |
| Molecular Formula | C17H28N4O5S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [4-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate |
| SMILES | CC(C)c1cc(NC(=O)[C@@H](N)CCC(N)=O)cc(C(C)C)c1OS(N)(=O)=O |
| InChI | InChI=1S/C17H28N4O5S/c1-9(2)12-7-11(21-17(23)14(18)5-6-15(19)22)8-13(10(3)4)16(12)26-27(20,24)25/h7-10,14H,5-6,18H2,1-4H3,(H2,19,22)(H,21,23)(H2,20,24,25)/t14-/m0/s1 |
| InChIKey | FFDBRZXZDRQSGU-AWEZNQCLSA-N |
| XLogP | 1.05 |
| TPSA | 167.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |