C35H58Cl2N4O5S — CID 70132142
[4-(2,6-diaminohexanoylamino)-2,6-di(propan-2-yl)phenyl] N-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]sulfamate;dihydrochloride (PubChem CID 70132142) has the molecular formula C35H58Cl2N4O5S and a molecular weight of 717.84 g/mol. Its IUPAC name is [4-(2,6-diaminohexanoylamino)-2,6-di(propan-2-yl)phenyl] N-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]sulfamate;dihydrochloride.
| Compound Name | [4-(2,6-diaminohexanoylamino)-2,6-di(propan-2-yl)phenyl] N-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]sulfamate;dihydrochloride |
|---|---|
| PubChem CID | 70132142 |
| Molecular Formula | C35H58Cl2N4O5S |
| Molecular Weight | 717.84 g/mol |
| Exact Mass | 716.35 |
| IUPAC Name | [4-(2,6-diaminohexanoylamino)-2,6-di(propan-2-yl)phenyl] N-[2-[2,4,6-tri(propan-2-yl)phenyl]acetyl]sulfamate;dihydrochloride |
| SMILES | CC(C)c1cc(C(C)C)c(CC(=O)NS(=O)(=O)Oc2c(C(C)C)cc(NC(=O)C(N)CCCCN)cc2C(C)C)c(C(C)C)c1.Cl.Cl |
| InChI | InChI=1S/C35H56N4O5S.2ClH/c1-20(2)25-15-27(21(3)4)31(28(16-25)22(5)6)19-33(40)39-45(42,43)44-34-29(23(7)8)17-26(18-30(34)24(9)10)38-35(41)32(37)13-11-12-14-36;;/h15-18,20-24,32H,11-14,19,36-37H2,1-10H3,(H,38,41)(H,39,40);2*1H |
| InChIKey | JJWTUKOUHKXLCQ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 153.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.84 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|