C21H37N3O2 — CID 174455912
tert-butyl N-(5-cyclohexyl-1H-imidazol-2-yl)-N-heptylcarbamate (PubChem CID 174455912) has the molecular formula C21H37N3O2 and a molecular weight of 363.55 g/mol. Its IUPAC name is tert-butyl N-(5-cyclohexyl-1H-imidazol-2-yl)-N-heptylcarbamate.
| Compound Name | tert-butyl N-(5-cyclohexyl-1H-imidazol-2-yl)-N-heptylcarbamate |
|---|---|
| PubChem CID | 174455912 |
| Molecular Formula | C21H37N3O2 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.29 |
| IUPAC Name | tert-butyl N-(5-cyclohexyl-1H-imidazol-2-yl)-N-heptylcarbamate |
| SMILES | CCCCCCCN(C(=O)OC(C)(C)C)c1ncc(C2CCCCC2)[nH]1 |
| InChI | InChI=1S/C21H37N3O2/c1-5-6-7-8-12-15-24(20(25)26-21(2,3)4)19-22-16-18(23-19)17-13-10-9-11-14-17/h16-17H,5-15H2,1-4H3,(H,22,23) |
| InChIKey | FXTIGMBFPXMZOP-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|