C18H25N5O4 — CID 174456242
nitroso 2-(1,3-benzoxazol-2-yl)-2-(diaminomethylideneamino)decanoate (PubChem CID 174456242) has the molecular formula C18H25N5O4 and a molecular weight of 375.43 g/mol. Its IUPAC name is nitroso 2-(1,3-benzoxazol-2-yl)-2-(diaminomethylideneamino)decanoate.
| Compound Name | nitroso 2-(1,3-benzoxazol-2-yl)-2-(diaminomethylideneamino)decanoate |
|---|---|
| PubChem CID | 174456242 |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | nitroso 2-(1,3-benzoxazol-2-yl)-2-(diaminomethylideneamino)decanoate |
| SMILES | CCCCCCCCC(N=C(N)N)(C(=O)ON=O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C18H25N5O4/c1-2-3-4-5-6-9-12-18(22-17(19)20,16(24)27-23-25)15-21-13-10-7-8-11-14(13)26-15/h7-8,10-11H,2-6,9,12H2,1H3,(H4,19,20,22) |
| InChIKey | IWWOCQJJOLXINB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 146.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|