C27H33FN6O6S — CID 174457989
[carbamothioyl-[[3-[3-fluoro-4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]amino] 4-[(dimethylamino)methyl]benzoate (PubChem CID 174457989) has the molecular formula C27H33FN6O6S and a molecular weight of 588.66 g/mol. Its IUPAC name is [carbamothioyl-[[3-[3-fluoro-4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]amino] 4-[(dimethylamino)methyl]benzoate.
| Compound Name | [carbamothioyl-[[3-[3-fluoro-4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]amino] 4-[(dimethylamino)methyl]benzoate |
|---|---|
| PubChem CID | 174457989 |
| Molecular Formula | C27H33FN6O6S |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | [carbamothioyl-[[3-[3-fluoro-4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]amino] 4-[(dimethylamino)methyl]benzoate |
| SMILES | CN(C)Cc1ccc(C(=O)ON(CC2CN(c3ccc(N4CCN(C(=O)CO)CC4)c(F)c3)C(=O)O2)C(N)=S)cc1 |
| InChI | InChI=1S/C27H33FN6O6S/c1-30(2)14-18-3-5-19(6-4-18)25(37)40-34(26(29)41)16-21-15-33(27(38)39-21)20-7-8-23(22(28)13-20)31-9-11-32(12-10-31)24(36)17-35/h3-8,13,21,35H,9-12,14-17H2,1-2H3,(H2,29,41) |
| InChIKey | UJHUEWYQRIWIAC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|