C26H26ClN3O4S — CID 174461107
(3S)-4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3-(methoxymethyl)-1-[[4-(6-oxo-1H-pyridin-3-yl)phenyl]methyl]piperazine-2-carbaldehyde (PubChem CID 174461107) has the molecular formula C26H26ClN3O4S and a molecular weight of 512.03 g/mol. Its IUPAC name is (3S)-4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3-(methoxymethyl)-1-[[4-(6-oxo-1H-pyridin-3-yl)phenyl]methyl]piperazine-2-carbaldehyde.
| Compound Name | (3S)-4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3-(methoxymethyl)-1-[[4-(6-oxo-1H-pyridin-3-yl)phenyl]methyl]piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174461107 |
| Molecular Formula | C26H26ClN3O4S |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | (3S)-4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3-(methoxymethyl)-1-[[4-(6-oxo-1H-pyridin-3-yl)phenyl]methyl]piperazine-2-carbaldehyde |
| SMILES | COC[C@@H]1C(C=O)N(Cc2ccc(-c3ccc(=O)[nH]c3)cc2)CCN1C(=O)/C=C/c1ccc(Cl)s1 |
| InChI | InChI=1S/C26H26ClN3O4S/c1-34-17-23-22(16-31)29(12-13-30(23)26(33)11-8-21-7-9-24(27)35-21)15-18-2-4-19(5-3-18)20-6-10-25(32)28-14-20/h2-11,14,16,22-23H,12-13,15,17H2,1H3,(H,28,32)/b11-8+/t22?,23-/m1/s1 |
| InChIKey | DPUWKRHNPVFPAB-ZUVFFLMPSA-N |
| XLogP | 3.70 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|