C26H26ClN3O3S — CID 67014916
4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-1-[[4-(6-oxo-1H-pyridin-3-yl)phenyl]methyl]-3-propylpiperazin-2-one (PubChem CID 67014916) has the molecular formula C26H26ClN3O3S and a molecular weight of 496.03 g/mol. Its IUPAC name is 4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-1-[[4-(6-oxo-1H-pyridin-3-yl)phenyl]methyl]-3-propylpiperazin-2-one.
| Compound Name | 4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-1-[[4-(6-oxo-1H-pyridin-3-yl)phenyl]methyl]-3-propylpiperazin-2-one |
|---|---|
| PubChem CID | 67014916 |
| Molecular Formula | C26H26ClN3O3S |
| Molecular Weight | 496.03 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-1-[[4-(6-oxo-1H-pyridin-3-yl)phenyl]methyl]-3-propylpiperazin-2-one |
| SMILES | CCCC1C(=O)N(Cc2ccc(-c3ccc(=O)[nH]c3)cc2)CCN1C(=O)/C=C/c1ccc(Cl)s1 |
| InChI | InChI=1S/C26H26ClN3O3S/c1-2-3-22-26(33)29(14-15-30(22)25(32)13-10-21-9-11-23(27)34-21)17-18-4-6-19(7-5-18)20-8-12-24(31)28-16-20/h4-13,16,22H,2-3,14-15,17H2,1H3,(H,28,31)/b13-10+ |
| InChIKey | LRVKXTVDIBZLLF-JLHYYAGUSA-N |
| XLogP | 4.81 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.03 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|