C27H27ClN2O2S — CID 67109799
(3S)-4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3-ethyl-6-methyl-1-[(4-phenylphenyl)methyl]piperazin-2-one (PubChem CID 67109799) has the molecular formula C27H27ClN2O2S and a molecular weight of 479.05 g/mol. Its IUPAC name is (3S)-4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3-ethyl-6-methyl-1-[(4-phenylphenyl)methyl]piperazin-2-one.
| Compound Name | (3S)-4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3-ethyl-6-methyl-1-[(4-phenylphenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 67109799 |
| Molecular Formula | C27H27ClN2O2S |
| Molecular Weight | 479.05 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | (3S)-4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3-ethyl-6-methyl-1-[(4-phenylphenyl)methyl]piperazin-2-one |
| SMILES | CC[C@H]1C(=O)N(Cc2ccc(-c3ccccc3)cc2)C(C)CN1C(=O)/C=C/c1ccc(Cl)s1 |
| InChI | InChI=1S/C27H27ClN2O2S/c1-3-24-27(32)29(18-20-9-11-22(12-10-20)21-7-5-4-6-8-21)19(2)17-30(24)26(31)16-14-23-13-15-25(28)33-23/h4-16,19,24H,3,17-18H2,1-2H3/b16-14+/t19?,24-/m0/s1 |
| InChIKey | CSBOZDOLFWPELI-CTMGSCHOSA-N |
| XLogP | 6.12 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.05 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|