C11H19N3O2S — CID 174468655
N-[2-(2,5-diamino-3,4-dimethylphenyl)ethyl]methanesulfonamide (PubChem CID 174468655) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is N-[2-(2,5-diamino-3,4-dimethylphenyl)ethyl]methanesulfonamide.
| Compound Name | N-[2-(2,5-diamino-3,4-dimethylphenyl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 174468655 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[2-(2,5-diamino-3,4-dimethylphenyl)ethyl]methanesulfonamide |
| SMILES | Cc1c(N)cc(CCNS(C)(=O)=O)c(N)c1C |
| InChI | InChI=1S/C11H19N3O2S/c1-7-8(2)11(13)9(6-10(7)12)4-5-14-17(3,15)16/h6,14H,4-5,12-13H2,1-3H3 |
| InChIKey | FHFZKTUTEXQUAX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|