C13H25N3O2S+2 — CID 23382922
[4-azaniumyl-3-[2-(methanesulfonamido)ethyl]phenyl]-diethylazanium (PubChem CID 23382922) has the molecular formula C13H25N3O2S+2 and a molecular weight of 287.43 g/mol. Its IUPAC name is [4-azaniumyl-3-[2-(methanesulfonamido)ethyl]phenyl]-diethylazanium.
| Compound Name | [4-azaniumyl-3-[2-(methanesulfonamido)ethyl]phenyl]-diethylazanium |
|---|---|
| PubChem CID | 23382922 |
| Molecular Formula | C13H25N3O2S+2 |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | [4-azaniumyl-3-[2-(methanesulfonamido)ethyl]phenyl]-diethylazanium |
| SMILES | CC[NH+](CC)c1ccc([NH3+])c(CCNS(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H23N3O2S/c1-4-16(5-2)12-6-7-13(14)11(10-12)8-9-15-19(3,17)18/h6-7,10,15H,4-5,8-9,14H2,1-3H3/p+2 |
| InChIKey | RGQFFQXJSCXIJX-UHFFFAOYSA-P |
| XLogP | -0.79 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|