C16H20NO5S- — CID 174471289
1-[[2-(2-formyloxyethyl)cyclohexen-1-yl]-sulfinatoamino]-4-methoxybenzene (PubChem CID 174471289) has the molecular formula C16H20NO5S- and a molecular weight of 338.40 g/mol. Its IUPAC name is 1-[[2-(2-formyloxyethyl)cyclohexen-1-yl]-sulfinatoamino]-4-methoxybenzene.
| Compound Name | 1-[[2-(2-formyloxyethyl)cyclohexen-1-yl]-sulfinatoamino]-4-methoxybenzene |
|---|---|
| PubChem CID | 174471289 |
| Molecular Formula | C16H20NO5S- |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 1-[[2-(2-formyloxyethyl)cyclohexen-1-yl]-sulfinatoamino]-4-methoxybenzene |
| SMILES | COc1ccc(N(C2=C(CCOC=O)CCCC2)S(=O)[O-])cc1 |
| InChI | InChI=1S/C16H21NO5S/c1-21-15-8-6-14(7-9-15)17(23(19)20)16-5-3-2-4-13(16)10-11-22-12-18/h6-9,12H,2-5,10-11H2,1H3,(H,19,20)/p-1 |
| InChIKey | QCELCJBBKVVABM-UHFFFAOYSA-M |
| XLogP | 2.69 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|