C17H22NO4S- — CID 174471300
1-ethyl-2-[[2-(2-formyloxyethyl)cyclohex-2-en-1-yl]-sulfinatoamino]benzene (PubChem CID 174471300) has the molecular formula C17H22NO4S- and a molecular weight of 336.43 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(2-formyloxyethyl)cyclohex-2-en-1-yl]-sulfinatoamino]benzene.
| Compound Name | 1-ethyl-2-[[2-(2-formyloxyethyl)cyclohex-2-en-1-yl]-sulfinatoamino]benzene |
|---|---|
| PubChem CID | 174471300 |
| Molecular Formula | C17H22NO4S- |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-ethyl-2-[[2-(2-formyloxyethyl)cyclohex-2-en-1-yl]-sulfinatoamino]benzene |
| SMILES | CCc1ccccc1N(C1CCCC=C1CCOC=O)S(=O)[O-] |
| InChI | InChI=1S/C17H23NO4S/c1-2-14-7-3-5-9-16(14)18(23(20)21)17-10-6-4-8-15(17)11-12-22-13-19/h3,5,7-9,13,17H,2,4,6,10-12H2,1H3,(H,20,21)/p-1 |
| InChIKey | WSUCDCQANXCVGU-UHFFFAOYSA-M |
| XLogP | 2.89 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|