C15H16Cl2NO4S- — CID 174471275
1,2-dichloro-3-[[2-(2-formyloxyethyl)cyclohex-2-en-1-yl]-sulfinatoamino]benzene (PubChem CID 174471275) has the molecular formula C15H16Cl2NO4S- and a molecular weight of 377.27 g/mol. Its IUPAC name is 1,2-dichloro-3-[[2-(2-formyloxyethyl)cyclohex-2-en-1-yl]-sulfinatoamino]benzene.
| Compound Name | 1,2-dichloro-3-[[2-(2-formyloxyethyl)cyclohex-2-en-1-yl]-sulfinatoamino]benzene |
|---|---|
| PubChem CID | 174471275 |
| Molecular Formula | C15H16Cl2NO4S- |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 1,2-dichloro-3-[[2-(2-formyloxyethyl)cyclohex-2-en-1-yl]-sulfinatoamino]benzene |
| SMILES | O=COCCC1=CCCCC1N(c1cccc(Cl)c1Cl)S(=O)[O-] |
| InChI | InChI=1S/C15H17Cl2NO4S/c16-12-5-3-7-14(15(12)17)18(23(20)21)13-6-2-1-4-11(13)8-9-22-10-19/h3-5,7,10,13H,1-2,6,8-9H2,(H,20,21)/p-1 |
| InChIKey | ULAHRWGYSYURBG-UHFFFAOYSA-M |
| XLogP | 3.64 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|