C17H22O5S — CID 174471295
2-[6-[(4-methoxyphenyl)methylsulfonyl]cyclohexen-1-yl]ethyl formate (PubChem CID 174471295) has the molecular formula C17H22O5S and a molecular weight of 338.42 g/mol. Its IUPAC name is 2-[6-[(4-methoxyphenyl)methylsulfonyl]cyclohexen-1-yl]ethyl formate.
| Compound Name | 2-[6-[(4-methoxyphenyl)methylsulfonyl]cyclohexen-1-yl]ethyl formate |
|---|---|
| PubChem CID | 174471295 |
| Molecular Formula | C17H22O5S |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-[6-[(4-methoxyphenyl)methylsulfonyl]cyclohexen-1-yl]ethyl formate |
| SMILES | COc1ccc(CS(=O)(=O)C2CCCC=C2CCOC=O)cc1 |
| InChI | InChI=1S/C17H22O5S/c1-21-16-8-6-14(7-9-16)12-23(19,20)17-5-3-2-4-15(17)10-11-22-13-18/h4,6-9,13,17H,2-3,5,10-12H2,1H3 |
| InChIKey | JTRZPQAOKSUZRV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|