C25H29NO3 — CID 174478867
(2S)-4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-benzyl-4-oxo-2-phenylbutanoic acid (PubChem CID 174478867) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is (2S)-4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-benzyl-4-oxo-2-phenylbutanoic acid.
| Compound Name | (2S)-4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-benzyl-4-oxo-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 174478867 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (2S)-4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-benzyl-4-oxo-2-phenylbutanoic acid |
| SMILES | O=C(C[C@](Cc1ccccc1)(C(=O)O)c1ccccc1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C25H29NO3/c27-23(26-17-20-11-7-8-12-21(20)18-26)16-25(24(28)29,22-13-5-2-6-14-22)15-19-9-3-1-4-10-19/h1-6,9-10,13-14,20-21H,7-8,11-12,15-18H2,(H,28,29)/t20?,21?,25-/m0/s1 |
| InChIKey | IXRDCFSAJZSPQR-BAWHURIHSA-N |
| XLogP | 4.29 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |