C25H31ClN6O3S — CID 174482079
1-[1-[2-(aminomethyl)-4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-3-tert-butylpyrazol-5-yl]-3-(4-chlorophenyl)urea (PubChem CID 174482079) has the molecular formula C25H31ClN6O3S and a molecular weight of 531.08 g/mol. Its IUPAC name is 1-[1-[2-(aminomethyl)-4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-3-tert-butylpyrazol-5-yl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[1-[2-(aminomethyl)-4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-3-tert-butylpyrazol-5-yl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 174482079 |
| Molecular Formula | C25H31ClN6O3S |
| Molecular Weight | 531.08 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 1-[1-[2-(aminomethyl)-4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-3-tert-butylpyrazol-5-yl]-3-(4-chlorophenyl)urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(Cl)cc2)n(-c2ccc(N3CCS(=O)(=O)CC3)cc2CN)n1 |
| InChI | InChI=1S/C25H31ClN6O3S/c1-25(2,3)22-15-23(29-24(33)28-19-6-4-18(26)5-7-19)32(30-22)21-9-8-20(14-17(21)16-27)31-10-12-36(34,35)13-11-31/h4-9,14-15H,10-13,16,27H2,1-3H3,(H2,28,29,33) |
| InChIKey | REZSWBYHASCMCW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 122.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.08 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|