C20H19N3O3 — CID 174484937
2-hydroxy-N-[6-(4-hydroxyphenyl)pyrimidin-4-yl]-2-methyl-3-phenylpropanamide (PubChem CID 174484937) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-hydroxy-N-[6-(4-hydroxyphenyl)pyrimidin-4-yl]-2-methyl-3-phenylpropanamide.
| Compound Name | 2-hydroxy-N-[6-(4-hydroxyphenyl)pyrimidin-4-yl]-2-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 174484937 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-hydroxy-N-[6-(4-hydroxyphenyl)pyrimidin-4-yl]-2-methyl-3-phenylpropanamide |
| SMILES | CC(O)(Cc1ccccc1)C(=O)Nc1cc(-c2ccc(O)cc2)ncn1 |
| InChI | InChI=1S/C20H19N3O3/c1-20(26,12-14-5-3-2-4-6-14)19(25)23-18-11-17(21-13-22-18)15-7-9-16(24)10-8-15/h2-11,13,24,26H,12H2,1H3,(H,21,22,23,25) |
| InChIKey | UBVWSWUIWITGLZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |