C6H13F3O3Sn2 — CID 174486985
methoxy-[methoxy(4,4,4-trifluorobutyl)stannyl]oxytin (PubChem CID 174486985) has the molecular formula C6H13F3O3Sn2 and a molecular weight of 427.58 g/mol. Its IUPAC name is methoxy-[methoxy(4,4,4-trifluorobutyl)stannyl]oxytin.
| Compound Name | methoxy-[methoxy(4,4,4-trifluorobutyl)stannyl]oxytin |
|---|---|
| PubChem CID | 174486985 |
| Molecular Formula | C6H13F3O3Sn2 |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 429.89 |
| IUPAC Name | methoxy-[methoxy(4,4,4-trifluorobutyl)stannyl]oxytin |
| SMILES | CO[Sn]O[SnH](CCCC(F)(F)F)OC |
| InChI | InChI=1S/C4H6F3.2CH3O.O.2Sn.H/c1-2-3-4(5,6)7;2*1-2;;;;/h1-3H2;2*1H3;;;;/q;2*-1;;2*+1; |
| InChIKey | KAWWZOCQOUIXAL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |