C31H54O5 — CID 174490795
3-oxobutanoyl (Z)-2-oxo-3,3-di(propan-2-yl)henicos-12-enoate (PubChem CID 174490795) has the molecular formula C31H54O5 and a molecular weight of 506.77 g/mol. Its IUPAC name is 3-oxobutanoyl (Z)-2-oxo-3,3-di(propan-2-yl)henicos-12-enoate.
| Compound Name | 3-oxobutanoyl (Z)-2-oxo-3,3-di(propan-2-yl)henicos-12-enoate |
|---|---|
| PubChem CID | 174490795 |
| Molecular Formula | C31H54O5 |
| Molecular Weight | 506.77 g/mol |
| Exact Mass | 506.40 |
| IUPAC Name | 3-oxobutanoyl (Z)-2-oxo-3,3-di(propan-2-yl)henicos-12-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(C(=O)C(=O)OC(=O)CC(C)=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H54O5/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-31(25(2)3,26(4)5)29(34)30(35)36-28(33)24-27(6)32/h14-15,25-26H,7-13,16-24H2,1-6H3/b15-14- |
| InChIKey | VUQWWKGFCHPETN-PFONDFGASA-N |
| XLogP | 8.33 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.77 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|