About tert-butyl 5-(4-chlorophenyl)-3-[(4,4-difluoropiperidin-1-yl)carbamoyl]pyrazine-2-carboxylate
tert-butyl 5-(4-chlorophenyl)-3-[(4,4-difluoropiperidin-1-yl)carbamoyl]pyrazine-2-carboxylate (PubChem CID 174491189) has the molecular formula C21H23ClF2N4O3
and a molecular weight of 452.89 g/mol. Its IUPAC name is tert-butyl 5-(4-chlorophenyl)-3-[(4,4-difluoropiperidin-1-yl)carbamoyl]pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 5-(4-chlorophenyl)-3-[(4,4-difluoropiperidin-1-yl)carbamoyl]pyrazine-2-carboxylate |
| PubChem CID | 174491189 |
| Molecular Formula | C21H23ClF2N4O3 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | tert-butyl 5-(4-chlorophenyl)-3-[(4,4-difluoropiperidin-1-yl)carbamoyl]pyrazine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ncc(-c2ccc(Cl)cc2)nc1C(=O)NN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C21H23ClF2N4O3/c1-20(2,3)31-19(30)17-16(18(29)27-28-10-8-21(23,24)9-11-28)26-15(12-25-17)13-4-6-14(22)7-5-13/h4-7,12H,8-11H2,1-3H3,(H,27,29) |
| InChIKey | XJSOCRYRBUMEKT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 5-(4-chlorophenyl)-3-[(4,4-difluoropiperidin-1-yl)carbamoyl]pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-(4-chlorophenyl)-3-[(4,4-difluoropiperidin-1-yl)carbamoyl]pyrazine-2-carboxylate?
The IUPAC name of tert-butyl 5-(4-chlorophenyl)-3-[(4,4-difluoropiperidin-1-yl)carbamoyl]pyrazine-2-carboxylate (CID 174491189) is tert-butyl 5-(4-chlorophenyl)-3-[(4,4-difluoropiperidin-1-yl)carbamoyl]pyrazine-2-carboxylate.
What is the SMILES notation for tert-butyl 5-(4-chlorophenyl)-3-[(4,4-difluoropiperidin-1-yl)carbamoyl]pyrazine-2-carboxylate?
The canonical SMILES for tert-butyl 5-(4-chlorophenyl)-3-[(4,4-difluoropiperidin-1-yl)carbamoyl]pyrazine-2-carboxylate is CC(C)(C)OC(=O)c1ncc(-c2ccc(Cl)cc2)nc1C(=O)NN1CCC(F)(F)CC1.
What is the InChIKey of tert-butyl 5-(4-chlorophenyl)-3-[(4,4-difluoropiperidin-1-yl)carbamoyl]pyrazine-2-carboxylate?
The InChIKey is XJSOCRYRBUMEKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23ClF2N4O3/c1-20(2,3)31-19(30)17-16(18(29)27-28-10-8-21(23,24)9-11-28)26-15(12-25-17)13-4-6-14(22)7-5-13/h4-7,12H,8-11H2,1-3H3,(H,27,29).
What are the key properties of tert-butyl 5-(4-chlorophenyl)-3-[(4,4-difluoropiperidin-1-yl)carbamoyl]pyrazine-2-carboxylate?
tert-butyl 5-(4-chlorophenyl)-3-[(4,4-difluoropiperidin-1-yl)carbamoyl]pyrazine-2-carboxylate has a molecular weight of 452.89 g/mol, XLogP of 4.13, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-(4-chlorophenyl)-3-[(4,4-difluoropiperidin-1-yl)carbamoyl]pyrazine-2-carboxylate is sourced from PubChem (CID 174491189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).