C26H28Cl2N4O3 — CID 69458691
tert-butyl 5,6-bis(4-chlorophenyl)-3-[(2-methylpropylamino)carbamoyl]pyrazine-2-carboxylate (PubChem CID 69458691) has the molecular formula C26H28Cl2N4O3 and a molecular weight of 515.44 g/mol. Its IUPAC name is tert-butyl 5,6-bis(4-chlorophenyl)-3-[(2-methylpropylamino)carbamoyl]pyrazine-2-carboxylate.
| Compound Name | tert-butyl 5,6-bis(4-chlorophenyl)-3-[(2-methylpropylamino)carbamoyl]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 69458691 |
| Molecular Formula | C26H28Cl2N4O3 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | tert-butyl 5,6-bis(4-chlorophenyl)-3-[(2-methylpropylamino)carbamoyl]pyrazine-2-carboxylate |
| SMILES | CC(C)CNNC(=O)c1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)nc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H28Cl2N4O3/c1-15(2)14-29-32-24(33)22-23(25(34)35-26(3,4)5)31-21(17-8-12-19(28)13-9-17)20(30-22)16-6-10-18(27)11-7-16/h6-13,15,29H,14H2,1-5H3,(H,32,33) |
| InChIKey | CWBPKLRJORRFNS-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|