C26H30N2O5S — CID 174491193
[[1-ethyl-7-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]-4-oxoquinolin-3-yl]-phenylmethyl] formate (PubChem CID 174491193) has the molecular formula C26H30N2O5S and a molecular weight of 482.60 g/mol. Its IUPAC name is [[1-ethyl-7-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]-4-oxoquinolin-3-yl]-phenylmethyl] formate.
| Compound Name | [[1-ethyl-7-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]-4-oxoquinolin-3-yl]-phenylmethyl] formate |
|---|---|
| PubChem CID | 174491193 |
| Molecular Formula | C26H30N2O5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | [[1-ethyl-7-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]-4-oxoquinolin-3-yl]-phenylmethyl] formate |
| SMILES | CCn1cc(C(OC=O)c2ccccc2)c(=O)c2ccc(SCCNC(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C26H30N2O5S/c1-5-28-16-21(24(32-17-29)18-9-7-6-8-10-18)23(30)20-12-11-19(15-22(20)28)34-14-13-27-25(31)33-26(2,3)4/h6-12,15-17,24H,5,13-14H2,1-4H3,(H,27,31) |
| InChIKey | UWPMZQSRRVRAQT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|