C14H20O6 — CID 174494346
1-(1-hydroxyethyl)-3-methyl-2-prop-2-enoylcyclohexane-1,2-dicarboxylic acid (PubChem CID 174494346) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is 1-(1-hydroxyethyl)-3-methyl-2-prop-2-enoylcyclohexane-1,2-dicarboxylic acid.
| Compound Name | 1-(1-hydroxyethyl)-3-methyl-2-prop-2-enoylcyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 174494346 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-(1-hydroxyethyl)-3-methyl-2-prop-2-enoylcyclohexane-1,2-dicarboxylic acid |
| SMILES | C=CC(=O)C1(C(=O)O)C(C)CCCC1(C(=O)O)C(C)O |
| InChI | InChI=1S/C14H20O6/c1-4-10(16)14(12(19)20)8(2)6-5-7-13(14,9(3)15)11(17)18/h4,8-9,15H,1,5-7H2,2-3H3,(H,17,18)(H,19,20) |
| InChIKey | QHMQUGWZCYCCJO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|