C18H18Cl4N2O — CID 174500067
4-chloro-N-[(2,3-dichlorophenyl)methyl]-N-[(2R)-4-iminobutan-2-yl]benzamide;hydrochloride (PubChem CID 174500067) has the molecular formula C18H18Cl4N2O and a molecular weight of 420.17 g/mol. Its IUPAC name is 4-chloro-N-[(2,3-dichlorophenyl)methyl]-N-[(2R)-4-iminobutan-2-yl]benzamide;hydrochloride.
| Compound Name | 4-chloro-N-[(2,3-dichlorophenyl)methyl]-N-[(2R)-4-iminobutan-2-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 174500067 |
| Molecular Formula | C18H18Cl4N2O |
| Molecular Weight | 420.17 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | 4-chloro-N-[(2,3-dichlorophenyl)methyl]-N-[(2R)-4-iminobutan-2-yl]benzamide;hydrochloride |
| SMILES | Cl.[H]/N=C/C[C@@H](C)N(Cc1cccc(Cl)c1Cl)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17Cl3N2O.ClH/c1-12(9-10-22)23(11-14-3-2-4-16(20)17(14)21)18(24)13-5-7-15(19)8-6-13;/h2-8,10,12,22H,9,11H2,1H3;1H/b22-10+;/t12-;/m1./s1 |
| InChIKey | ZTZILZSDXLQJIN-YRLPQZNRSA-N |
| XLogP | 6.14 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.17 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|